3-Acetaminophthalic anhydride, English name: N- (1,3-Dioxo-1, 3-dihydro-2-benzofuran-4-yl) acetamide, CAS: 6296-53-3, Formula: C10H7NO4, Molecular weight
6296-53-3
3-Acetaminophthalic anhydride (N- (1,3-Dioxo-1,3-dihydro-2-benzofuran-4-yl) acetamide)
CAS: 6296-53-3
Chemical formula: C10H7NO4
<"" ="xl" "">| Chinese name | 3-Acetaminophthalic anhydride |
| English name | N-(1,3-Dioxo-1,3-dihydro-2-benzofuran-4-yl)acetamide |
| alias | Apst intermediate Apst intermediate anhydride 3-Acetaminophthalic anhydride 1,3-Dioxo-2-isoindoline acetic acid 3-Acetaminophthalic anhydride (Apst intermediate) N- (1,3-dioxo-4-isobenzofuran) acetamide |
| English alias | NSC 16261 3-Acetamidophthalic anhydride 3-AcetaMidophthalic anhydride 3-AcetylaMinophthalic Anhydride 3-AcetylaMino-phthalsaeure-anhydrid N-(1,3-Dioxo-1,3-dihydro-2-benzofuran-4-yl)acetaMide N-(1,3-Dihydro-1,3-dioxoisobenzofuran-4-yl)acetamide N-(1,3-Dioxo-1,3-dihydro-2-benzofuran-4-yl)acetamide AcetaMide, N-(1,3-dihydro-1,3-dioxo-4-isobenzofuranyl)- acetamide, N-(1,3-dihydro-1,3-dioxo-4-isobenzofuranyl)- |
| CAS | 6296-53-3 |
| EINECS | 808-040-8 |
| chemical formula | C10H7NO4 |
| molecular weight | 205.17 |
| InChI | InChI=1/C10H7NO4/c1-5(12)11-7-4-2-3-6-8(7)10(14)15-9(6)13/h2-4H,1H3,(H,11,12) |
| density | 1.512±0.06 g/cm3(Predicted) |
| melting point | 185-186℃ |
| Boiling Point | 489.1±28.0 °C(Predicted) |
| flash point | 249.6°C |
| vapor pressure | 1.03E-09mmHg at 25°C |
| solubility | Chloroform (light, sonication), ethyl acetate (light, sonication), methanol |
| refractive index | 1.657 |
| acidity coefficient | 13.81±0.20(Predicted) |
| storage conditions | Inert atmosphere,Room Temperature |
| stability | humidity sensitive |
| appearance | solid |
| color | Off-White to Pale Yellow |
| MDL number | A151652 |
6296-53-3 - brief introduction
3-Acetaminophthalic anhydride is an organic compound. The following is an introduction to its properties, uses, preparation methods, and safety information:Nature:
3-Acetaminophthalic anhydride is a yellowish crystalline solid.
It is soluble in organic solvents such as ethanol, acetone, and dichloromethane, but insoluble in water.
Purpose:
3-Acetaminophthalic anhydride is often used as an important reagent in organic synthesis.
It has high reactivity and selectivity and is widely used in organic synthesis.
Production method:
A commonly used preparation method is obtained by reacting 3-acetamido-phthalic acid with anhydride.
The reaction is generally carried out in a dry and inert atmosphere, usually using acid catalysts such as sulfuric acid.
Safety information:
The toxicity of 3-acetaminophthalic anhydride is moderate.
Avoid inhalation, ingestion, or contact with skin and eyes.
Wear appropriate personal protective equipment such as chemical gloves, goggles, and protective clothing when handling.
Last Updated: 2024-04-09 21:04:16
