1,10-Phenanthroline-5-formic acid, English name: 10-phenanthroline-5-carboxylic acid, CAS: 630067-06-0, Chemical formula: C13H8N2O2, Molecular weight: 224.21, Density:
630067-06-0
1,10-Phenanthroline-5-formic acid (10-phenanthroline-5-carboxylic acid)
CAS: 630067-06-0
Chemical formula: C13H8N2O2
<"" ="xl" "">| Chinese name | 1,10-phenanthroline-5-formic acid |
| English name | 1,10-phenanthroline-5-carboxylic acid |
| alias | 1,10-phenanthroline-5-formic acid 5-formic acid-1,10-phenanthroline 1,10-phenanthroline-5-carboxylic acid 5-Carboxyl-1,10-phenanthroline 5-formic acid-1,10-phenanthroline 5-Carboxyl-1,10-phenanthroline 1,10-phenanthroline-5-formic acid |
| English alias | 5-carboxylic acid 1,10-PHENANTHROLINE-5-CARBOXYLICACID 1,10-phenanthroline-5-carboxylic acid 1,10-Phenanthroline-5-carboxylic acid 1,10-PHENANTHROLINE-5-CARBOXYLICACID630067-06-0 |
| CAS | 630067-06-0 |
| chemical formula | C13H8N2O2 |
| molecular weight | 224.21 |
| InChI | InChI=1/C13H8N2O2/c16-13(17)10-7-8-3-1-5-14-11(8)12-9(10)4-2-6-15-12/h1-7H,(H,16,17) |
| density | 1.431 |
| melting point | 335-337 °C (decomp)(Solv: methanol (67-56-1)) |
| Boiling Point | 467.2±30.0 °C(Predicted) |
| flash point | 236.3°C |
| vapor pressure | 1.57E-09mmHg at 25°C |
| refractive index | 1.769 |
| acidity coefficient | 1.83±0.30(Predicted) |
| storage conditions | under inert gas (nitrogen or Argon) at 2-8°C |
630067-06-0 - brief introduction
1,10-Phenanthroline-5-formic acid is an organic compound. It is a white to light yellow crystal that is soluble in acids, bases, and organic solvents.1,10-Phenanthroline-5-carboxylic acid is often used as a ligand and reagent in many fields. In chemical analysis, it is usually used for the quantitative analysis of metal ions, especially when combined with iron ions, it can form a complex with strong absorption. It can also be used in the synthesis of organometallic complexes, fluorescent dyes and photocatalysts.
A method for preparing 1,10-phenanthroline-5-formic acid comprises the steps of: reacting 1,10-phenanthroline with formic anhydride to generate 1,10-phenanthroline-5-formic anhydride; and then hydrolyzing 1,10-phenanthroline-5-formic anhydride to obtain 1,10-phenanthroline-5-formic acid.
1,10-Phenanthroline-5-formic acid is safe, but care should still be taken to prevent inhalation and contact with skin or eyes. Wear protective gloves and glasses when using to avoid inhalation of its dust or vapors. Make sure to use in a well-ventilated place and store it properly to avoid fire or explosion.Last Updated: 2024-04-10 22:29:15
