Diethyl 4-oxopimelate, English name: diethyl 4-oxopimelate, CAS: 6317-49-3, Chemical formula: C11H18O5, Molecular weight: 230.26, Density: 1.073g/mLat 25 ° C (lit.)
6317-49-3
Diethyl 4-oxopimelate (diethyl 4-oxopimelate)
CAS: 6317-49-3
Chemical formula: C11H18O5
<"" ="xl" "">| Chinese name | Diethyl 4-oxoheptanoate |
| English name | diethyl 4-oxopimelate |
| alias | Diethyl 4-ketoheptanoate Diethyl 4-oxo-heptanoate Diethyl 4-carbonylheptanoate Diethyl 4-oxoheptanoate Diethyl 4-oxycarbonylheptanoate Diethyl 4-oxoheptanoate |
| English alias | diethyl 4-oxopimelate DIETHYL 4-OXOPIMELATE DIETHYL G-KETOPIMELATE 4-Oxopimelic acid diethyl DIETHYL-GAMMA-OXOPIMELATE Diethyl gamma-ketopimelate Diethyl 4-oxoheptanedioate diethyl 4-oxoheptanedioate 4-Oxopimelic acid diethyl ester 4-Oxoheptanedioic acid diethyl ester Heptanedioic acid, 4-oxo-, diethyl ester |
| CAS | 6317-49-3 |
| EINECS | 228-657-0 |
| chemical formula | C11H18O5 |
| molecular weight | 230.26 |
| InChI | InChI=1/C11H18O5/c1-3-15-10(13)7-5-9(12)6-8-11(14)16-4-2/h3-8H2,1-2H3 |
| InChIKey | ZGBUXZJMZBBISR-UHFFFAOYSA-N |
| density | 1.073g/mLat 25°C(lit.) |
| melting point | 58 °C(Solv: benzene (71-43-2); ligroine (8032-32-4)) |
| Boiling Point | 144°C/0.6mmHg |
| flash point | >230°F |
| vapor pressure | 0.000359mmHg at 25°C |
| solubility | Chloroform (slightly soluble), methanol (slightly soluble) |
| refractive index | n20/D 1,441 (lit.) |
| storage conditions | Sealed in dry,Room Temperature |
| appearance | Lubricating oil |
| color | Colourless to Pale Yellow |
| BRN | 1571968 |
| security terms | S23 - Do not inhale steam. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 3 |
| FLUKA BRAND F CODES | 8-9 |
| Hazard Class | IRRITANT |
| downstream products | 4,4-difluorocyclohexanone |
6317-49-3 - brief introduction
Diethyl 4-oxopimelate, also known as diethyl 4-oxopimelate, is an organic compound.Nature:
Appearance: Diethyl 4-oxoheptanoate is a colorless to light yellow liquid.
Solubility: Diethyl 4-oxoheptanoate is soluble in some organic solvents such as ethanol, methanol, and ether.
Purpose:
Diethyl 4-oxoheptanoate is often used as an intermediate in organic synthesis.
It can be used to synthesize a variety of organic compounds, such as esters, acids, and amides.
Production method:
Diethyl 4-oxoheptanoate can be prepared by reacting diethyl heptanoate with diethyl heptanoate in amounts of an activator such as nickel tricarbonyl.
Safety information:
When using and storing, care should be taken to avoid contact with strong oxidizing agents, strong acids, and strong bases to avoid dangerous reactions.
When handling diethyl 4-oxoheptanoate, wear appropriate protective gloves and goggles to ensure that the operation is carried out in a well-ventilated environment.Last Updated: 2024-04-10 22:29:15
